CAS 898759-12-1
:2-Methyl-1-(2-oxazolyl)-1-propanone
Description:
2-Methyl-1-(2-oxazolyl)-1-propanone, identified by its CAS number 898759-12-1, is an organic compound characterized by its unique structural features. It contains a ketone functional group, which is indicative of its reactivity and potential applications in organic synthesis. The presence of a 2-oxazolyl group suggests that it may exhibit heterocyclic properties, contributing to its chemical behavior and interactions. This compound is likely to be a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It may have moderate solubility in organic solvents, which is typical for compounds containing both aliphatic and heterocyclic structures. The compound's molecular structure allows for potential applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. Additionally, its reactivity may be influenced by the presence of the oxazole ring, which can participate in various chemical reactions, including nucleophilic substitutions or cycloadditions. As with any chemical substance, safety data sheets should be consulted for handling and storage guidelines.
Formula:C7H9NO2
InChI:InChI=1S/C7H9NO2/c1-5(2)6(9)7-8-3-4-10-7/h3-5H,1-2H3
InChI key:InChIKey=PUYVQDCWEITXJJ-UHFFFAOYSA-N
SMILES:C(C(C)C)(=O)C1=NC=CO1
Synonyms:- 2-Methyl-1-(2-oxazolyl)-1-propanone
- 1-Propanone, 2-methyl-1-(2-oxazolyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.