CymitQuimica logo

CAS 898759-13-2

:

2-[(2,4-dichlorophenyl)methyl]-1,3-dioxolane

Description:
2-[(2,4-Dichlorophenyl)methyl]-1,3-dioxolane is an organic compound characterized by its dioxolane ring structure, which consists of a five-membered ring containing two oxygen atoms. The presence of the 2,4-dichlorophenyl group indicates that the compound has two chlorine substituents on the aromatic ring, which can influence its reactivity and physical properties. This compound is likely to be a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It may exhibit moderate to high lipophilicity due to the aromatic and aliphatic components, which can affect its solubility in various organic solvents. The dioxolane moiety can participate in various chemical reactions, including nucleophilic substitutions and ring-opening reactions, making it a potentially useful intermediate in organic synthesis. Additionally, the presence of chlorine atoms can enhance biological activity, making this compound of interest in pharmaceutical and agrochemical research. Safety data should be consulted for handling and potential toxicity, as halogenated compounds can pose environmental and health risks.
Formula:C10H10Cl2O2
InChI:InChI=1/C10H10Cl2O2/c11-8-2-1-7(9(12)6-8)5-10-13-3-4-14-10/h1-2,6,10H,3-5H2
SMILES:c1cc(cc(c1CC1OCCO1)Cl)Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.