CAS 898759-15-4
:2-[(2,5-Dichlorophenyl)methyl]-1,3-dioxolane
Description:
2-[(2,5-Dichlorophenyl)methyl]-1,3-dioxolane is an organic compound characterized by its unique structural features, including a dioxolane ring and a dichlorophenyl group. The presence of the dioxolane moiety suggests that it may exhibit properties typical of cyclic ethers, such as moderate polarity and potential reactivity in nucleophilic substitution reactions. The dichlorophenyl substituent indicates that the compound may possess significant lipophilicity and could interact with biological systems, potentially influencing its pharmacological properties. This compound may also exhibit stability under standard conditions, but its reactivity can be influenced by the presence of the electron-withdrawing chlorine atoms, which can affect the electron density on the aromatic ring. Additionally, the compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. However, specific safety and handling guidelines should be followed, as with any chemical substance, to mitigate any risks associated with its use.
Formula:C10H10Cl2O2
InChI:InChI=1S/C10H10Cl2O2/c11-8-1-2-9(12)7(5-8)6-10-13-3-4-14-10/h1-2,5,10H,3-4,6H2
InChI key:InChIKey=XOHXLODPKNJRJD-UHFFFAOYSA-N
SMILES:C(C1=C(Cl)C=CC(Cl)=C1)C2OCCO2
Synonyms:- 2-[(2,5-Dichlorophenyl)methyl]-1,3-dioxolane
- 1,3-Dioxolane, 2-[(2,5-dichlorophenyl)methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.