CAS 898759-16-5
:3-Methyl-1-(2-oxazolyl)-1-butanone
Description:
3-Methyl-1-(2-oxazolyl)-1-butanone, identified by its CAS number 898759-16-5, is an organic compound characterized by its unique structural features. It contains a butanone backbone with a methyl group and a 2-oxazolyl substituent, which contributes to its chemical properties. This compound is typically a colorless to pale yellow liquid, exhibiting a distinctive odor. It is soluble in organic solvents, which is common for many ketones and heterocyclic compounds. The presence of the oxazole ring introduces heteroatoms into the structure, potentially influencing its reactivity and interactions with other chemical species. 3-Methyl-1-(2-oxazolyl)-1-butanone may be of interest in various applications, including pharmaceuticals, agrochemicals, or as a synthetic intermediate in organic chemistry. Its specific reactivity, stability, and potential biological activity would depend on the conditions under which it is used, as well as its interactions with other molecules. As with any chemical substance, proper handling and safety precautions are essential due to potential hazards associated with its use.
Formula:C8H11NO2
InChI:InChI=1S/C8H11NO2/c1-6(2)5-7(10)8-9-3-4-11-8/h3-4,6H,5H2,1-2H3
InChI key:InChIKey=TUFDVWRJXRUCHW-UHFFFAOYSA-N
SMILES:C(CC(C)C)(=O)C1=NC=CO1
Synonyms:- 1-Butanone, 3-methyl-1-(2-oxazolyl)-
- 3-Methyl-1-(2-oxazolyl)-1-butanone
- 2-(3-Methylbutyryl)oxazole
- 3-Methyl-1-(1,3-oxazol-2-yl)butan-1-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.