CAS 898759-17-6

2-[(2,6-Dichlorophenyl)methyl]-1,3-dioxolane

Description:

2-[(2,6-Dichlorophenyl)methyl]-1,3-dioxolane is an organic compound characterized by its dioxolane ring structure, which consists of a five-membered ring containing two oxygen atoms and three carbon atoms. The presence of the 2,6-dichlorophenyl group indicates that the compound has two chlorine substituents on the phenyl ring, which can significantly influence its chemical properties, including its reactivity and polarity. This compound is likely to exhibit moderate to high lipophilicity due to the aromatic nature of the dichlorophenyl group, which may affect its solubility in organic solvents. Additionally, the dioxolane moiety can participate in various chemical reactions, such as nucleophilic substitutions or ring-opening reactions, making it a versatile intermediate in organic synthesis. Its potential applications may include use in pharmaceuticals, agrochemicals, or as a building block in the synthesis of more complex molecules. Safety and handling precautions should be observed, as with many chlorinated compounds, due to potential toxicity and environmental concerns.

Formula: C₁₀H₁₀Cl₂O₂

InChI: InChI=1S/C10H10Cl2O2/c11-8-2-1-3-9(12)7(8)6-10-13-4-5-14-10/h1-3,10H,4-6H2

InChI key: InChIKey=NVJNYQVIHYPKNC-UHFFFAOYSA-N

SMILES: C(C1=C(Cl)C=CC=C1Cl)C2OCCO2

Synonyms:

• 2-[(2,6-Dichlorophenyl)methyl]-1,3-dioxolane
• 1,3-Dioxolane, 2-[(2,6-dichlorophenyl)methyl]-