CAS 898759-19-8

2-[(3,5-dichlorophenyl)methyl]-1,3-dioxolane

Description:

2-[(3,5-Dichlorophenyl)methyl]-1,3-dioxolane is an organic compound characterized by its dioxolane ring structure, which consists of a five-membered ring containing two oxygen atoms. The presence of the 3,5-dichlorophenyl group indicates that the compound has two chlorine substituents on the aromatic ring, contributing to its chemical reactivity and potential biological activity. This compound is likely to exhibit moderate polarity due to the electronegative chlorine atoms and the dioxolane moiety, which can influence its solubility in various solvents. The dioxolane ring can also participate in various chemical reactions, such as nucleophilic substitutions or ring-opening reactions, making it a versatile intermediate in organic synthesis. Additionally, the presence of the dichlorophenyl group may enhance the compound's lipophilicity, potentially affecting its pharmacokinetic properties if it is studied for biological applications. Overall, 2-[(3,5-dichlorophenyl)methyl]-1,3-dioxolane is a compound of interest in both synthetic organic chemistry and medicinal chemistry contexts.

Formula: C₁₀H₁₀Cl₂O₂

InChI: InChI=1/C10H10Cl2O2/c11-8-3-7(4-9(12)6-8)5-10-13-1-2-14-10/h3-4,6,10H,1-2,5H2

SMILES: C1COC(Cc2cc(cc(c2)Cl)Cl)O1

1,3-Dichloro-5-(1,3-dioxolan-2-ylmethyl)benzene

CAS: 898759-19-8

Formula: C₁₀H₁₀Cl₂O₂

Purity: 97.0%

Molecular weight: 233.09

Ref: 10-F208229