CymitQuimica logo

CAS 898759-23-4

:

2-methyl-1-oxazol-2-yl-pentan-1-one

Description:
2-Methyl-1-oxazol-2-yl-pentan-1-one is a chemical compound characterized by its oxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen. This compound features a methyl group at the 2-position of the oxazole ring and a pentan-1-one chain, indicating the presence of a ketone functional group. The molecular structure contributes to its potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of the oxazole moiety often imparts unique biological activities, making it of interest in medicinal chemistry. Additionally, the compound's physical properties, such as solubility and melting point, can be influenced by the functional groups and the overall molecular architecture. As with many organic compounds, safety and handling precautions should be observed, as the specific toxicity and environmental impact of 2-methyl-1-oxazol-2-yl-pentan-1-one would depend on its chemical behavior and interactions. Further studies may be required to fully elucidate its properties and potential applications.
Formula:C9H13NO2
InChI:InChI=1/C9H13NO2/c1-3-4-7(2)8(11)9-10-5-6-12-9/h5-7H,3-4H2,1-2H3
SMILES:CCCC(C)C(=O)c1ncco1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.