CAS 898759-25-6

(2-chlorophenyl)-[3-(1,3-dioxolan-2-yl)phenyl]methanone

Description:

The chemical substance known as (2-chlorophenyl)-[3-(1,3-dioxolan-2-yl)phenyl]methanone, with the CAS number 898759-25-6, is an organic compound characterized by its complex structure that includes a chlorophenyl group and a dioxolane moiety. This compound typically exhibits properties associated with aromatic ketones, such as stability and potential reactivity due to the presence of the carbonyl group. The chlorophenyl substituent may influence its electronic properties, potentially enhancing its reactivity in electrophilic aromatic substitution reactions. The dioxolane ring contributes to the compound's overall polarity and solubility characteristics, which can affect its behavior in various solvents. Additionally, the presence of the dioxolane may impart specific biological activities, making this compound of interest in medicinal chemistry and material science. Overall, its unique structural features suggest potential applications in pharmaceuticals or as a synthetic intermediate in organic synthesis.

Formula: C₁₆H₁₃ClO₃

InChI: InChI=1/C16H13ClO3/c17-14-7-2-1-6-13(14)15(18)11-4-3-5-12(10-11)16-19-8-9-20-16/h1-7,10,16H,8-9H2

SMILES: c1ccc(c(c1)C(=O)c1cccc(c1)C1OCCO1)Cl

2-chloro-3'-(1,3-dioxolan-2-yl)benzophenone

CAS: 898759-25-6

Purity: 97.0%

Molecular weight: 288.7300109863281

Ref: 10-F206822