CAS 898759-34-7
:[3-(1,3-dioxolan-2-yl)phenyl]-[4-(trifluoromethyl)phenyl]methanone
Description:
The chemical substance known as [3-(1,3-dioxolan-2-yl)phenyl]-[4-(trifluoromethyl)phenyl]methanone, with the CAS number 898759-34-7, is characterized by its complex molecular structure that includes a phenyl ring substituted with a trifluoromethyl group and a methanone functional group. The presence of the 1,3-dioxolane moiety contributes to its potential reactivity and solubility properties. This compound is likely to exhibit significant lipophilicity due to the trifluoromethyl group, which can enhance its biological activity and interaction with various biological targets. Additionally, the dioxolane ring may impart stability and influence the compound's overall polarity. Such characteristics suggest potential applications in pharmaceuticals or agrochemicals, where the unique structural features can be leveraged for specific interactions or activities. As with many organic compounds, its physical properties, such as melting point, boiling point, and solubility, would need to be determined experimentally for practical applications.
Formula:C17H13F3O3
InChI:InChI=1/C17H13F3O3/c18-17(19,20)14-6-4-11(5-7-14)15(21)12-2-1-3-13(10-12)16-22-8-9-23-16/h1-7,10,16H,8-9H2
SMILES:c1cc(cc(c1)C1OCCO1)C(=O)c1ccc(cc1)C(F)(F)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.