CymitQuimica logo

CAS 898759-36-9

:

2-[(2,5-dimethylphenyl)methyl]-1,3-dioxolane

Description:
2-[(2,5-Dimethylphenyl)methyl]-1,3-dioxolane is an organic compound characterized by its dioxolane ring structure, which consists of a five-membered ring containing two oxygen atoms. This compound features a phenyl group substituted with two methyl groups at the 2 and 5 positions, contributing to its hydrophobic characteristics and potential for various interactions in chemical reactions. The presence of the dioxolane moiety suggests that it may exhibit properties typical of cyclic ethers, such as moderate polarity and the ability to participate in nucleophilic reactions. The compound's structure indicates potential applications in organic synthesis, particularly in the development of pharmaceuticals or as an intermediate in chemical processes. Additionally, its unique substitution pattern may influence its physical properties, such as boiling point and solubility, making it of interest in both academic research and industrial applications. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C12H16O2
InChI:InChI=1/C12H16O2/c1-9-3-4-10(2)11(7-9)8-12-13-5-6-14-12/h3-4,7,12H,5-6,8H2,1-2H3
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.