CymitQuimica logo

CAS 898759-38-1

:

1-(2-Oxazolyl)-2-propyl-1-pentanone

Description:
1-(2-Oxazolyl)-2-propyl-1-pentanone, identified by its CAS number 898759-38-1, is an organic compound characterized by the presence of a 2-oxazole ring and a pentanone structure. This compound typically exhibits properties associated with both ketones and heterocycles, which may influence its reactivity and solubility. The oxazole moiety contributes to its potential as a ligand in coordination chemistry and may also impart biological activity, making it of interest in medicinal chemistry. The propyl group attached to the carbon chain can affect the compound's hydrophobicity and overall molecular interactions. In terms of physical properties, it may be a liquid or solid at room temperature, depending on its specific structure and purity. Its applications could range from pharmaceuticals to agrochemicals, depending on its biological activity and chemical reactivity. Safety data and handling precautions should be consulted, as with any chemical substance, to ensure proper usage and minimize risks.
Formula:C11H17NO2
InChI:InChI=1/C11H17NO2/c1-3-5-9(6-4-2)10(13)11-12-7-8-14-11/h7-9H,3-6H2,1-2H3
InChI key:InChIKey=MYOKYMZQUXDWIG-UHFFFAOYSA-N
SMILES:C(C(=O)C1=NC=CO1)(CCC)CCC
Synonyms:
  • 1-(2-Oxazolyl)-2-propyl-1-pentanone
  • 1-Pentanone, 1-(2-oxazolyl)-2-propyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.