CAS 898759-40-5
:(2-chloro-4-fluoro-phenyl)-[3-(1,3-dioxolan-2-yl)phenyl]methanone
Description:
The chemical substance known as (2-chloro-4-fluoro-phenyl)-[3-(1,3-dioxolan-2-yl)phenyl]methanone, with the CAS number 898759-40-5, is a synthetic organic compound characterized by its complex structure that includes a phenyl ring substituted with both chlorine and fluorine atoms, as well as a methanone functional group. The presence of a 1,3-dioxolane ring indicates that this compound may exhibit interesting properties related to its reactivity and stability, particularly in terms of its potential as a pharmacophore in medicinal chemistry. The chlorine and fluorine substituents can influence the compound's lipophilicity, electronic properties, and overall biological activity. Additionally, the compound's molecular structure suggests potential applications in drug development, particularly in targeting specific biological pathways. Its synthesis and characterization would typically involve standard organic chemistry techniques, including NMR and mass spectrometry for confirmation of structure and purity. Overall, this compound represents a class of molecules that may have significant implications in pharmaceutical research and development.
Formula:C16H12ClFO3
InChI:InChI=1/C16H12ClFO3/c17-14-9-12(18)4-5-13(14)15(19)10-2-1-3-11(8-10)16-20-6-7-21-16/h1-5,8-9,16H,6-7H2
SMILES:c1cc(cc(c1)C1OCCO1)C(=O)c1ccc(cc1Cl)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.