CymitQuimica logo

CAS 898759-47-2

:

(3-methoxyphenyl)-oxazol-2-yl-methanone

Description:
(3-Methoxyphenyl)-oxazol-2-yl-methanone, identified by its CAS number 898759-47-2, is a chemical compound characterized by its unique structural features. It consists of an oxazole ring, which is a five-membered heterocyclic compound containing both nitrogen and oxygen atoms, fused with a methanone group and a 3-methoxyphenyl substituent. The presence of the methoxy group enhances its solubility and may influence its reactivity and interaction with biological systems. This compound is likely to exhibit properties typical of both aromatic and heterocyclic compounds, such as stability and potential for various chemical reactions, including electrophilic substitutions. Its structural characteristics suggest potential applications in pharmaceuticals or as a building block in organic synthesis. However, specific biological activities, toxicity, and environmental impact would require further investigation through empirical studies. Overall, (3-methoxyphenyl)-oxazol-2-yl-methanone represents a versatile compound with potential utility in various chemical and medicinal contexts.
Formula:C11H9NO3
InChI:InChI=1/C11H9NO3/c1-14-9-4-2-3-8(7-9)10(13)11-12-5-6-15-11/h2-7H,1H3
SMILES:COc1cccc(c1)C(=O)c1ncco1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.