CAS 898759-49-4

(2,3-Dichlorophenyl)[3-(1,3-dioxolan-2-yl)phenyl]methanone

Description:

(2,3-Dichlorophenyl)[3-(1,3-dioxolan-2-yl)phenyl]methanone, with the CAS number 898759-49-4, is an organic compound characterized by its complex structure, which includes a dichlorophenyl group and a phenyl moiety linked through a methanone functional group. The presence of the 1,3-dioxolane ring contributes to its potential reactivity and solubility properties, making it of interest in various chemical applications. This compound is likely to exhibit moderate to high lipophilicity due to the aromatic rings, which can influence its interaction with biological systems. The dichlorine substituents may enhance its electrophilic character, potentially making it a candidate for further chemical transformations. Additionally, the compound's structure suggests potential applications in pharmaceuticals or agrochemicals, where such functional groups are often associated with biological activity. As with many organic compounds, safety and handling precautions should be observed, given the presence of chlorine atoms, which can pose environmental and health risks.

Formula: C₁₆H₁₂Cl₂O₃

InChI: InChI=1S/C16H12Cl2O3/c17-13-6-2-5-12(14(13)18)15(19)10-3-1-4-11(9-10)16-20-7-8-21-16/h1-6,9,16H,7-8H2

InChI key: InChIKey=NHBFQJYMRAUGQV-UHFFFAOYSA-N

SMILES: C(=O)(C=1C=C(C=CC1)C2OCCO2)C3=C(Cl)C(Cl)=CC=C3

Synonyms:

• (2,3-Dichlorophenyl)[3-(1,3-dioxolan-2-yl)phenyl]methanone
• Methanone, (2,3-dichlorophenyl)[3-(1,3-dioxolan-2-yl)phenyl]-
• 2,3-Dichloro-3′-(1,3-dioxolan-2-yl)benzophenone

2,3-dichloro-3'-(1,3-dioxolan-2-yl)benzophenone

CAS: 898759-49-4

Purity: 97.0%

Molecular weight: 323.1700134277344

Ref: 10-F206831