CAS 898759-52-9
:(2,4-dichlorophenyl)-[3-(1,3-dioxolan-2-yl)phenyl]methanone
Description:
(2,4-Dichlorophenyl)-[3-(1,3-dioxolan-2-yl)phenyl]methanone, identified by its CAS number 898759-52-9, is a synthetic organic compound characterized by its complex molecular structure. It features a dichlorophenyl group, which contributes to its potential biological activity, and a phenyl ring substituted with a 1,3-dioxolane moiety, enhancing its chemical reactivity and solubility properties. This compound is likely to exhibit properties typical of ketones, including the ability to participate in various chemical reactions such as nucleophilic additions. Its dioxolane ring may also impart stability and influence its interaction with biological targets. The presence of chlorine atoms can enhance lipophilicity and affect the compound's pharmacokinetics. Overall, this compound may be of interest in medicinal chemistry and material science, although specific applications would depend on further research into its biological activity and chemical behavior. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity and environmental impact.
Formula:C16H12Cl2O3
InChI:InChI=1/C16H12Cl2O3/c17-12-4-5-13(14(18)9-12)15(19)10-2-1-3-11(8-10)16-20-6-7-21-16/h1-5,8-9,16H,6-7H2
SMILES:c1cc(cc(c1)C1OCCO1)C(=O)c1ccc(cc1Cl)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.