CAS 898759-53-0
:o-tolyl-oxazol-2-yl-methanone
Description:
o-Tolyl-oxazol-2-yl-methanone, identified by its CAS number 898759-53-0, is an organic compound characterized by the presence of an oxazole ring and a tolyl group. The oxazole moiety contributes to its heterocyclic nature, which can impart unique chemical reactivity and properties. Typically, compounds like this may exhibit biological activity, making them of interest in pharmaceutical research. The methanone functional group suggests the presence of a carbonyl (C=O) group, which can participate in various chemical reactions, such as nucleophilic additions or condensation reactions. The tolyl group, derived from toluene, introduces hydrophobic characteristics, potentially influencing the compound's solubility and interaction with biological membranes. Overall, the structural features of o-tolyl-oxazol-2-yl-methanone suggest it may have applications in medicinal chemistry or as a building block in organic synthesis, although specific biological activities and applications would require further investigation.
Formula:C11H9NO2
InChI:InChI=1/C11H9NO2/c1-8-4-2-3-5-9(8)10(13)11-12-6-7-14-11/h2-7H,1H3
SMILES:Cc1ccccc1C(=O)c1ncco1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.