CAS 898759-55-2

Methanone, (2,5-dichlorophenyl)[3-(1,3-dioxolan-2-yl)phenyl]-

Description:

Methanone, (2,5-dichlorophenyl)[3-(1,3-dioxolan-2-yl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of the 2,5-dichlorophenyl group indicates that the compound has chlorine substituents at the 2 and 5 positions of a phenyl ring, contributing to its reactivity and potential biological activity. Additionally, the compound features a 1,3-dioxolane ring, which is a five-membered cyclic ether that can influence the compound's solubility and stability. This structure suggests potential applications in pharmaceuticals or agrochemicals, as many compounds with similar frameworks exhibit significant biological properties. The molecular interactions and properties of this compound can be influenced by the electron-withdrawing effects of the chlorine atoms and the steric effects of the dioxolane moiety. Overall, Methanone, (2,5-dichlorophenyl)[3-(1,3-dioxolan-2-yl)phenyl]- represents a class of compounds that may be of interest in synthetic organic chemistry and medicinal chemistry research.

Formula: C₁₆H₁₂Cl₂O₃

InChI: InChI=1S/C16H12Cl2O3/c17-12-4-5-14(18)13(9-12)15(19)10-2-1-3-11(8-10)16-20-6-7-21-16/h1-5,8-9,16H,6-7H2

InChI key: InChIKey=QYGJAHNLHCLYNI-UHFFFAOYSA-N

SMILES: C(=O)(C=1C=C(C=CC1)C2OCCO2)C3=C(Cl)C=CC(Cl)=C3

Synonyms:

• Methanone, (2,5-dichlorophenyl)[3-(1,3-dioxolan-2-yl)phenyl]-
• 2,5-Dichloro-3′-(1,3-dioxolan-2-yl)benzophenone
• (2,5-Dichlorophenyl)[3-(1,3-dioxolan-2-yl)phenyl]methanone

2,5-dichloro-3'-(1,3-dioxolan-2-yl)benzophenone

CAS: 898759-55-2

Purity: 97.0%

Molecular weight: 323.1700134277344

Ref: 10-F206833