CymitQuimica logo

CAS 898759-56-3

:

(3-Methylphenyl)-2-oxazolylmethanone

Description:
(3-Methylphenyl)-2-oxazolylmethanone, identified by its CAS number 898759-56-3, is an organic compound characterized by its unique structural features. It consists of a 2-oxazolyl group, which is a five-membered heterocyclic ring containing both nitrogen and oxygen, fused to a phenyl ring that has a methyl substituent at the meta position. This compound typically exhibits properties associated with aromatic compounds, such as stability and potential for various chemical reactions, including electrophilic substitutions. The presence of the oxazole moiety may impart additional reactivity, particularly in condensation reactions or as a ligand in coordination chemistry. Its molecular structure suggests potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. The compound's solubility, melting point, and other physical properties would depend on its specific interactions with solvents and other chemical environments. Overall, (3-Methylphenyl)-2-oxazolylmethanone represents a versatile building block in organic chemistry with potential utility in various chemical applications.
Formula:C11H9NO2
InChI:InChI=1S/C11H9NO2/c1-8-3-2-4-9(7-8)10(13)11-12-5-6-14-11/h2-7H,1H3
InChI key:InChIKey=BVKZBYGGVZJBIF-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(C)=CC=C1)C2=NC=CO2
Synonyms:
  • Methanone, (3-methylphenyl)-2-oxazolyl-
  • (3-Methylphenyl)-2-oxazolylmethanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.