CAS 898759-57-4

1,3-Dioxolane, 2-[(4-fluoro-2-methylphenyl)methyl]-

Description:

1,3-Dioxolane, 2-[(4-fluoro-2-methylphenyl)methyl]- is an organic compound characterized by its dioxolane ring structure, which consists of a five-membered cyclic ether containing two oxygen atoms. This compound features a phenyl group substituted with a fluorine atom and a methyl group, contributing to its unique chemical properties. The presence of the fluorine atom typically enhances the compound's lipophilicity and may influence its reactivity and biological activity. The dioxolane moiety is known for its stability and is often used as a solvent or in the synthesis of other organic compounds. The compound's molecular structure suggests potential applications in pharmaceuticals or agrochemicals, where the specific substitution patterns can affect its interaction with biological targets. Additionally, the presence of the dioxolane ring may impart certain physical properties, such as volatility and solubility, which are important for its practical applications. Overall, this compound exemplifies the diverse chemistry of substituted dioxolanes in organic synthesis and medicinal chemistry.

Formula: C₁₁H₁₃FO₂

InChI: InChI=1S/C11H13FO2/c1-8-6-10(12)3-2-9(8)7-11-13-4-5-14-11/h2-3,6,11H,4-5,7H2,1H3

InChI key: InChIKey=QPJFTCJHVNTXTE-UHFFFAOYSA-N

SMILES: C(C1=C(C)C=C(F)C=C1)C2OCCO2

Synonyms:

• 1,3-Dioxolane, 2-[(4-fluoro-2-methylphenyl)methyl]-

4-Fluoro-2-methyl (1,3-dioxolan-2-ylmethyl)benzene

CAS: 898759-57-4

Formula: C₁₁H₁₃FO₂

Purity: 96.0%

Molecular weight: 196.221

Ref: 10-F208249