CAS 898759-61-0

Methanone, (3,5-dichlorophenyl)[3-(1,3-dioxolan-2-yl)phenyl]-

Description:

Methanone, (3,5-dichlorophenyl)[3-(1,3-dioxolan-2-yl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and two distinct aromatic rings. The presence of the 3,5-dichlorophenyl group indicates that chlorine substituents are attached to the aromatic ring, which can influence the compound's reactivity and physical properties. The second aromatic ring is substituted with a 1,3-dioxolane moiety, a five-membered cyclic ether that contributes to the compound's overall stability and solubility characteristics. This compound may exhibit interesting biological activities due to its structural features, making it a subject of interest in medicinal chemistry. Its molecular interactions can be influenced by the electron-withdrawing nature of the chlorine atoms and the oxygen atoms in the dioxolane ring, which can affect its polarity and potential applications. As with many organic compounds, its properties such as melting point, boiling point, and solubility would depend on the specific conditions and the presence of other solvents or reagents.

Formula: C₁₆H₁₂Cl₂O₃

InChI: InChI=1S/C16H12Cl2O3/c17-13-7-12(8-14(18)9-13)15(19)10-2-1-3-11(6-10)16-20-4-5-21-16/h1-3,6-9,16H,4-5H2

InChI key: InChIKey=WWJJGBXGSJOPHZ-UHFFFAOYSA-N

SMILES: C(=O)(C=1C=C(C=CC1)C2OCCO2)C3=CC(Cl)=CC(Cl)=C3

Synonyms:

• (3,5-Dichlorophenyl)[3-(1,3-dioxolan-2-yl)phenyl]methanone
• Methanone, (3,5-dichlorophenyl)[3-(1,3-dioxolan-2-yl)phenyl]-

3,5-dichloro-3'-(1,3-dioxolan-2-yl)benzophenone

CAS: 898759-61-0

Purity: 97.0%

Molecular weight: 323.1700134277344

Ref: 10-F206835