CAS 898759-62-1

oxazol-2-yl-[2-(trifluoromethyl)phenyl]methanone

Description:

Oxazol-2-yl-[2-(trifluoromethyl)phenyl]methanone, identified by its CAS number 898759-62-1, is a chemical compound characterized by its unique structural features. It contains an oxazole ring, which is a five-membered heterocyclic compound featuring both nitrogen and oxygen atoms. The presence of a trifluoromethyl group (-CF3) on the phenyl ring significantly enhances its lipophilicity and can influence its reactivity and biological activity. This compound is likely to exhibit interesting properties due to the electron-withdrawing nature of the trifluoromethyl group, which can affect the acidity of adjacent functional groups and the overall electronic distribution within the molecule. Additionally, the methanone functional group contributes to its potential reactivity, making it a candidate for various chemical reactions, including nucleophilic attacks. Such compounds are often studied for their applications in pharmaceuticals, agrochemicals, and materials science due to their diverse chemical properties and potential biological activities.

Formula: C₁₁H₆F₃NO₂

InChI: InChI=1/C11H6F3NO2/c12-11(13,14)8-4-2-1-3-7(8)9(16)10-15-5-6-17-10/h1-6H

SMILES: c1ccc(c(c1)C(=O)c1ncco1)C(F)(F)F

Synonyms:

• Oxazol-2-yl(2-(trifluoromethyl)phenyl)methanone
• Methanone, 2-oxazolyl[2-(trifluoromethyl)phenyl]-
• 2-(2-TRIFLUOROMETHYLBENZOYL)OXAZOLE