CAS 898759-65-4

Methanone, (3,4-difluorophenyl)[3-(1,3-dioxolan-2-yl)phenyl]-

Description:

Methanone, (3,4-difluorophenyl)[3-(1,3-dioxolan-2-yl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and two distinct phenyl rings. One of these rings is substituted with two fluorine atoms at the 3 and 4 positions, enhancing its reactivity and potentially influencing its electronic properties. The other phenyl ring is connected to a 1,3-dioxolane moiety, a five-membered cyclic ether that contributes to the compound's overall stability and solubility in various solvents. This compound may exhibit interesting biological activities due to its unique structural features, making it a subject of interest in medicinal chemistry and drug design. Its molecular interactions can be influenced by the presence of the fluorine substituents, which can affect lipophilicity and binding affinity to biological targets. Overall, Methanone, (3,4-difluorophenyl)[3-(1,3-dioxolan-2-yl)phenyl]- represents a class of compounds that may have applications in pharmaceuticals or agrochemicals, pending further research into its properties and potential uses.

Formula: C₁₆H₁₂F₂O₃

InChI: InChI=1S/C16H12F2O3/c17-13-5-4-11(9-14(13)18)15(19)10-2-1-3-12(8-10)16-20-6-7-21-16/h1-5,8-9,16H,6-7H2

InChI key: InChIKey=HCDCMNUHMKUVRO-UHFFFAOYSA-N

SMILES: C(=O)(C=1C=C(C=CC1)C2OCCO2)C3=CC(F)=C(F)C=C3

Synonyms:

• (3,4-Difluorophenyl)[3-(1,3-dioxolan-2-yl)phenyl]methanone
• Methanone, (3,4-difluorophenyl)[3-(1,3-dioxolan-2-yl)phenyl]-

3,4-difluoro-3′-(1,3-dioxolan-2-yl)benzophenone

CAS: 898759-65-4

Formula: C₁₆H₁₂F₂O₃

Purity: 97.0%

Molecular weight: 290.266

Ref: 10-F206837