CAS 898759-69-8

(3-Fluorophenyl)-2-oxazolylmethanone

Description:

(3-Fluorophenyl)-2-oxazolylmethanone is a chemical compound characterized by its unique structural features, which include a fluorinated phenyl group and an oxazole ring. The presence of the fluorine atom typically enhances the compound's lipophilicity and can influence its biological activity. The oxazole moiety contributes to the compound's potential as a heterocyclic compound, often associated with various pharmacological properties. This compound may exhibit characteristics such as moderate to high stability under standard conditions, depending on the substituents and their electronic effects. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. Additionally, the compound's reactivity may be influenced by the functional groups present, allowing for various synthetic pathways. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of fluorine, which can impart unique toxicological properties. Overall, (3-Fluorophenyl)-2-oxazolylmethanone represents a class of compounds that are of interest in both research and industrial applications.

Formula: C₁₀H₆FNO₂

InChI: InChI=1/C10H6FNO2/c11-8-3-1-2-7(6-8)9(13)10-12-4-5-14-10/h1-6H

InChI key: InChIKey=VQNALHOKDDYTNY-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(F)=CC=C1)C2=NC=CO2

Synonyms:

• (3-Fluorophenyl)-2-oxazolylmethanone
• Methanone, (3-fluorophenyl)-2-oxazolyl-
• 2-(3-FLUOROBENZOYL)OXAZOLE
• (3-Fluorophenyl)(oxazol-2-yl)methanone