CAS 898759-70-1

Methanone, [3-(1,3-dioxolan-2-yl)phenyl](3,4,5-trifluorophenyl)-

Description:

Methanone, [3-(1,3-dioxolan-2-yl)phenyl](3,4,5-trifluorophenyl)-, is an organic compound characterized by its complex structure that includes a methanone functional group, a phenyl ring substituted with a 1,3-dioxolane moiety, and another phenyl ring that is heavily substituted with trifluoromethyl groups. The presence of the dioxolane ring suggests potential for reactivity and interactions typical of cyclic ethers, while the trifluorophenyl group contributes to the compound's electronic properties and may enhance its lipophilicity. This compound is likely to exhibit unique chemical behavior due to the electron-withdrawing nature of the trifluoromethyl groups, which can influence its reactivity and stability. Additionally, the presence of multiple functional groups may allow for various applications in medicinal chemistry or materials science, particularly in the development of pharmaceuticals or agrochemicals. Its specific properties, such as solubility, melting point, and reactivity, would depend on the overall molecular interactions and the environment in which it is studied.

Formula: C₁₆H₁₁F₃O₃

InChI: InChI=1/C16H11F3O3/c17-12-7-11(8-13(18)14(12)19)15(20)9-2-1-3-10(6-9)16-21-4-5-22-16/h1-3,6-8,16H,4-5H2

InChI key: InChIKey=JMRRXKDNTHIGQU-UHFFFAOYSA-N

SMILES: C(=O)(C=1C=C(C=CC1)C2OCCO2)C3=CC(F)=C(F)C(F)=C3

Synonyms:

• Methanone, [3-(1,3-dioxolan-2-yl)phenyl](3,4,5-trifluorophenyl)-
• [3-(1,3-Dioxolan-2-yl)phenyl](3,4,5-trifluorophenyl)methanone
• 3-(1,3-Dioxolan-2-yl)-3′,4′,5′-trifluorobenzophenone

3-(1,3-dioxolan-2-yl)-3′,4′,5′-trifluorobenzophenone

CAS: 898759-70-1

Formula: C₁₆H₁₁F₃O₃

Purity: 97.0%

Molecular weight: 308.256

Ref: 10-F206839