CAS 898759-71-2

(4-Fluorophenyl)-2-oxazolylmethanone

Description:

(4-Fluorophenyl)-2-oxazolylmethanone, identified by its CAS number 898759-71-2, is a chemical compound characterized by its unique structural features. It contains a fluorinated phenyl group, which enhances its reactivity and potential biological activity. The oxazole ring contributes to its heterocyclic nature, providing stability and influencing its electronic properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its functional groups suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with oxazole moieties are often associated with various biological activities. Additionally, the presence of the fluorine atom can enhance lipophilicity and metabolic stability, making it a candidate for further research in drug design. Safety and handling precautions should be observed, as with any chemical substance, to mitigate risks associated with its use.

Formula: C₁₀H₆FNO₂

InChI: InChI=1/C10H6FNO2/c11-8-3-1-7(2-4-8)9(13)10-12-5-6-14-10/h1-6H

InChI key: InChIKey=MZUVMBGDHXJAKO-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC=C(F)C=C1)C2=NC=CO2

Synonyms:

• 2-(4-Fluorobenzoyl)-1,3-oxazole
• (4-Fluorophenyl)-(1,3-oxazol-2-yl)methanone
• Methanone, (4-fluorophenyl)-2-oxazolyl-
• (4-Fluorophenyl)-2-oxazolylmethanone
• 2-(4-Fluorobenzoyl)oxazole