CymitQuimica logo

CAS 898759-72-3

:

Cyclopropyl[3-(1,3-dioxolan-2-yl)phenyl]methanone

Description:
Cyclopropyl[3-(1,3-dioxolan-2-yl)phenyl]methanone, with the CAS number 898759-72-3, is an organic compound characterized by its unique structural features. It contains a cyclopropyl group, which is a three-membered carbon ring known for its strain and reactivity, and a phenyl group substituted with a 1,3-dioxolane moiety, a five-membered ring containing two oxygen atoms. This compound is likely to exhibit interesting chemical properties due to the presence of both the strained cyclopropyl and the electron-withdrawing dioxolane, which can influence its reactivity and stability. The dioxolane ring can also participate in various chemical reactions, such as nucleophilic attacks or ring-opening reactions, depending on the reaction conditions. Additionally, the compound may have applications in medicinal chemistry or materials science, given the structural diversity it offers. Its specific physical properties, such as melting point, boiling point, and solubility, would need to be determined experimentally, as they can vary based on purity and environmental conditions.
Formula:C13H14O3
InChI:InChI=1S/C13H14O3/c14-12(9-4-5-9)10-2-1-3-11(8-10)13-15-6-7-16-13/h1-3,8-9,13H,4-7H2
InChI key:InChIKey=FGOZIZUKMHNYOX-UHFFFAOYSA-N
SMILES:C(=O)(C=1C=C(C=CC1)C2OCCO2)C3CC3
Synonyms:
  • Cyclopropyl[3-(1,3-dioxolan-2-yl)phenyl]methanone
  • Methanone, cyclopropyl[3-(1,3-dioxolan-2-yl)phenyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.