CymitQuimica logo

CAS 898759-75-6

:

(3-chlorophenyl)-oxazol-2-yl-methanone

Description:
(3-chlorophenyl)-oxazol-2-yl-methanone is a chemical compound characterized by its unique structure, which includes a chlorinated phenyl group and an oxazole ring. The presence of the oxazole moiety suggests potential biological activity, as oxazoles are often found in various pharmaceuticals and agrochemicals. The chlorophenyl group can enhance lipophilicity, potentially influencing the compound's solubility and permeability. This compound may exhibit properties such as antimicrobial, antifungal, or anticancer activities, typical of many oxazole derivatives. Its molecular structure allows for various interactions, including hydrogen bonding and π-π stacking, which can be significant in biological systems. Additionally, the compound's stability and reactivity can be influenced by the presence of the chlorine atom, which can participate in electrophilic substitution reactions. Overall, (3-chlorophenyl)-oxazol-2-yl-methanone represents a class of compounds with diverse applications in medicinal chemistry and material science, warranting further investigation into its properties and potential uses.
Formula:C10H6ClNO2
InChI:InChI=1/C10H6ClNO2/c11-8-3-1-2-7(6-8)9(13)10-12-4-5-14-10/h1-6H
InChI key:InChIKey=CKAUXCIIFHVJIO-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(Cl)=CC=C1)C2=NC=CO2
Synonyms:
  • 2-(3-Chlorobenzoyl)oxazole
  • (3-Chlorophenyl)-(1,3-oxazol-2-yl)methanone
  • 2-(3-Chlorobenzoyl)-1,3-oxazole
  • Methanone, (3-chlorophenyl)-2-oxazolyl-
  • (3-Chlorophenyl)-2-oxazolylmethanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.