CAS 898759-76-7

cyclopentyl-[3-(1,3-dioxolan-2-yl)phenyl]methanone

Description:

Cyclopentyl-[3-(1,3-dioxolan-2-yl)phenyl]methanone is an organic compound characterized by its unique structure, which includes a cyclopentyl group and a phenyl ring substituted with a 1,3-dioxolane moiety. This compound typically exhibits properties common to ketones, such as being a polar molecule due to the carbonyl group, which can engage in hydrogen bonding. The presence of the dioxolane ring may impart additional stability and influence its reactivity, making it potentially useful in various chemical reactions or as an intermediate in synthetic pathways. The compound's molecular structure suggests it may have applications in pharmaceuticals or materials science, where specific interactions with biological systems or other materials are desired. Its solubility characteristics would depend on the solvent used, with potential solubility in organic solvents due to its hydrophobic cyclopentyl and phenyl groups. Overall, cyclopentyl-[3-(1,3-dioxolan-2-yl)phenyl]methanone represents a versatile compound with interesting chemical properties that warrant further investigation for practical applications.

Formula: C₁₅H₁₈O₃

InChI: InChI=1/C15H18O3/c16-14(11-4-1-2-5-11)12-6-3-7-13(10-12)15-17-8-9-18-15/h3,6-7,10-11,15H,1-2,4-5,8-9H2

SMILES: C1CCC(C1)C(=O)c1cccc(c1)C1OCCO1