CAS 898759-78-9

Cyclohexyl[3-(1,3-dioxolan-2-yl)phenyl]methanone

Description:

Cyclohexyl[3-(1,3-dioxolan-2-yl)phenyl]methanone is an organic compound characterized by its unique structure, which includes a cyclohexyl group and a phenyl ring substituted with a 1,3-dioxolane moiety. This compound typically exhibits properties common to ketones, such as being a colorless to pale yellow liquid or solid, depending on its specific form and purity. It is likely to be soluble in organic solvents like ethanol and dichloromethane, while being less soluble in water due to its hydrophobic cyclohexyl and phenyl components. The presence of the dioxolane ring may impart some degree of polarity, influencing its reactivity and interactions with other chemical species. Cyclohexyl[3-(1,3-dioxolan-2-yl)phenyl]methanone may be utilized in various applications, including as an intermediate in organic synthesis or in the development of pharmaceuticals, owing to its potential biological activity. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₆H₂₀O₃

InChI: InChI=1/C16H20O3/c17-15(12-5-2-1-3-6-12)13-7-4-8-14(11-13)16-18-9-10-19-16/h4,7-8,11-12,16H,1-3,5-6,9-10H2

InChI key: InChIKey=JYBXZPRHCOFLCC-UHFFFAOYSA-N

SMILES: C(=O)(C=1C=C(C=CC1)C2OCCO2)C3CCCCC3

Synonyms:

• 2-(3-Cyclohexanecarbonylphenyl)-1,3-dioxolane
• Cyclohexyl[3-(1,3-dioxolan-2-yl)phenyl]methanone
• Methanone, cyclohexyl[3-(1,3-dioxolan-2-yl)phenyl]-

Cyclohexyl 3-(1,3-dioxolan-2-yl)phenyl ketone

CAS: 898759-78-9

Purity: 97.0%

Molecular weight: 260.3330078125

Ref: 10-F206843