CAS 898759-80-3

[4-(1,3-Dioxolan-2-yl)phenyl](2-methylphenyl)methanone

Description:

The chemical substance known as [4-(1,3-Dioxolan-2-yl)phenyl](2-methylphenyl)methanone, with the CAS number 898759-80-3, is an organic compound characterized by its complex structure that includes a phenyl group, a dioxolane ring, and a ketone functional group. This compound typically exhibits properties associated with aromatic compounds, such as stability and potential for electrophilic substitution reactions. The presence of the dioxolane moiety suggests that it may have interesting solubility characteristics and could participate in various chemical reactions, including ring-opening reactions under certain conditions. Additionally, the presence of the ketone group indicates that it may undergo typical carbonyl chemistry, such as nucleophilic addition. This compound may find applications in organic synthesis, pharmaceuticals, or as an intermediate in the production of more complex molecules. However, specific physical properties such as melting point, boiling point, and solubility would need to be determined experimentally or sourced from reliable databases for precise applications and handling guidelines.

Formula: C₁₇H₁₆O₃

InChI: InChI=1S/C17H16O3/c1-12-4-2-3-5-15(12)16(18)13-6-8-14(9-7-13)17-19-10-11-20-17/h2-9,17H,10-11H2,1H3

InChI key: InChIKey=OAANRGDHQABFEZ-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC=C(C=C1)C2OCCO2)C3=C(C)C=CC=C3

Synonyms:

• 2-[4-(2-Methylbenzoyl)phenyl]-1,3-dioxolane
• Methanone, [4-(1,3-dioxolan-2-yl)phenyl](2-methylphenyl)-
• [4-(1,3-Dioxolan-2-yl)phenyl](2-methylphenyl)methanone