CAS 898759-82-5

Methanone, [4-(1,3-dioxolan-2-yl)phenyl](3-methylphenyl)-

Description:

Methanone, [4-(1,3-dioxolan-2-yl)phenyl](3-methylphenyl)-, identified by the CAS number 898759-82-5, is an organic compound characterized by its complex structure that includes a methanone functional group and a phenyl ring substituted with a 1,3-dioxolane moiety. This compound typically exhibits properties associated with aromatic ketones, such as stability and moderate reactivity. The presence of the dioxolane ring suggests potential for participation in various chemical reactions, including nucleophilic attacks and ring-opening reactions under certain conditions. Additionally, the presence of the methyl group on the phenyl ring may influence its electronic properties and steric hindrance, affecting its reactivity and interactions with other molecules. Methanone derivatives often find applications in organic synthesis, pharmaceuticals, and materials science due to their versatile reactivity and ability to form complex structures. As with many organic compounds, safety and handling precautions should be observed, as they may pose health risks or environmental hazards.

Formula: C₁₇H₁₆O₃

InChI: InChI=1S/C17H16O3/c1-12-3-2-4-15(11-12)16(18)13-5-7-14(8-6-13)17-19-9-10-20-17/h2-8,11,17H,9-10H2,1H3

InChI key: InChIKey=IGXRCXYMCBVLFJ-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC=C(C=C1)C2OCCO2)C3=CC(C)=CC=C3

Synonyms:

• [4-(1,3-Dioxolan-2-yl)phenyl](3-methylphenyl)methanone
• 4′-(1,3-Dioxolan-2-yl)-3-methylbenzophenone
• Methanone, [4-(1,3-dioxolan-2-yl)phenyl](3-methylphenyl)-

4'-(1,3-dioxolan-2-yl)-3-methylbenzophenone

CAS: 898759-82-5

Purity: 97.0%

Molecular weight: 268.31201171875

Ref: 10-F206846