CAS 898759-84-7

Methanone, [4-(1,3-dioxolan-2-yl)phenyl](4-methylphenyl)-

Description:

Methanone, [4-(1,3-dioxolan-2-yl)phenyl](4-methylphenyl)-, also known by its CAS number 898759-84-7, is an organic compound characterized by its complex structure that includes a methanone functional group and a phenyl ring substituted with a 1,3-dioxolane moiety. This compound typically exhibits properties associated with aromatic ketones, such as moderate volatility and solubility in organic solvents. The presence of the dioxolane ring suggests potential for reactivity in various chemical transformations, particularly in nucleophilic additions or cycloadditions. Its molecular structure may impart specific physical properties, including melting and boiling points that are influenced by intermolecular interactions. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry and material science. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards. Overall, Methanone, [4-(1,3-dioxolan-2-yl)phenyl](4-methylphenyl)- represents a unique chemical entity with potential applications in various fields.

Formula: C₁₇H₁₆O₃

InChI: InChI=1S/C17H16O3/c1-12-2-4-13(5-3-12)16(18)14-6-8-15(9-7-14)17-19-10-11-20-17/h2-9,17H,10-11H2,1H3

InChI key: InChIKey=BTMYIZGGINBBPH-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC=C(C=C1)C2OCCO2)C3=CC=C(C)C=C3

Synonyms:

• Methanone, [4-(1,3-dioxolan-2-yl)phenyl](4-methylphenyl)-
• 4-(1,3-Dioxolan-2-yl)-4′-methylbenzophenone
• [4-(1,3-Dioxolan-2-yl)phenyl](4-methylphenyl)methanone

4-(1,3-dioxolan-2-yl)-4'-methylbenzophenone

CAS: 898759-84-7

Purity: 97.0%

Molecular weight: 268.31201171875

Ref: 10-F206847