CymitQuimica logo

CAS 898759-85-8

:

(3-iodophenyl)-oxazol-2-yl-methanone

Description:
(3-Iodophenyl)-oxazol-2-yl-methanone is a chemical compound characterized by its unique structure, which includes an oxazole ring and a phenyl group substituted with an iodine atom. The presence of the oxazole moiety contributes to its potential biological activity, as oxazoles are known for their roles in various pharmacological applications. The iodine substitution on the phenyl ring can enhance the compound's lipophilicity and may influence its reactivity and interaction with biological targets. This compound is typically synthesized through specific organic reactions that involve the formation of the oxazole ring and subsequent functionalization of the phenyl group. Its properties, such as solubility, melting point, and stability, can vary based on the specific conditions under which it is synthesized and stored. Additionally, the compound may exhibit interesting optical or electronic properties due to the presence of the iodine atom and the conjugated system formed by the oxazole and phenyl groups. Overall, (3-iodophenyl)-oxazol-2-yl-methanone represents a class of compounds with potential applications in medicinal chemistry and materials science.
Formula:C10H6INO2
InChI:InChI=1/C10H6INO2/c11-8-3-1-2-7(6-8)9(13)10-12-4-5-14-10/h1-6H
SMILES:c1cc(cc(c1)I)C(=O)c1ncco1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.