CAS 898759-87-0
:(4-iodophenyl)-oxazol-2-yl-methanone
Description:
(4-Iodophenyl)-oxazol-2-yl-methanone is an organic compound characterized by its unique structure, which includes an oxazole ring and a phenyl group substituted with an iodine atom. The presence of the oxazole ring imparts heterocyclic properties, making it potentially useful in various chemical reactions and applications. The iodine atom enhances the compound's reactivity, particularly in electrophilic substitution reactions, and can also influence its biological activity. This compound may exhibit interesting pharmacological properties, making it a candidate for further research in medicinal chemistry. Additionally, the methanone functional group contributes to its reactivity, allowing for potential derivatization. Overall, (4-iodophenyl)-oxazol-2-yl-methanone is a compound of interest in both synthetic organic chemistry and pharmaceutical development, with its characteristics suggesting potential utility in various applications, including as a building block for more complex molecules or as a lead compound in drug discovery.
Formula:C10H6INO2
InChI:InChI=1/C10H6INO2/c11-8-3-1-7(2-4-8)9(13)10-12-5-6-14-10/h1-6H
SMILES:c1cc(ccc1C(=O)c1ncco1)I
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.