CAS 898759-93-8
:2-Oxazolyl(3-phenoxyphenyl)methanone
Description:
2-Oxazolyl(3-phenoxyphenyl)methanone is a chemical compound characterized by its unique structural features, which include an oxazole ring and a phenoxyphenyl moiety. The oxazole ring contributes to its potential biological activity, as heterocycles often play significant roles in medicinal chemistry. The presence of the phenoxy group enhances its lipophilicity, potentially influencing its solubility and permeability in biological systems. This compound may exhibit various chemical properties, such as stability under standard conditions, and it may participate in reactions typical of carbonyl compounds, including nucleophilic addition and condensation. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of new therapeutic agents. Additionally, the compound's CAS number, 898759-93-8, allows for easy identification and retrieval of information in chemical databases. Overall, 2-Oxazolyl(3-phenoxyphenyl)methanone represents a class of compounds that could be of interest in research and development within organic and medicinal chemistry.
Formula:C16H11NO3
InChI:InChI=1S/C16H11NO3/c18-15(16-17-9-10-19-16)12-5-4-8-14(11-12)20-13-6-2-1-3-7-13/h1-11H
InChI key:InChIKey=BAUVHIVHPDOGEV-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(OC2=CC=CC=C2)=CC=C1)C3=NC=CO3
Synonyms:- 2-Oxazolyl(3-phenoxyphenyl)methanone
- Methanone, 2-oxazolyl(3-phenoxyphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.