CAS 898759-96-1

4-[4-(1,3-dioxolan-2-yl)benzoyl]benzonitrile

Description:

4-[4-(1,3-Dioxolan-2-yl)benzoyl]benzonitrile, identified by its CAS number 898759-96-1, is an organic compound characterized by its complex structure that includes a dioxolane ring and a nitrile functional group. The presence of the dioxolane moiety suggests that it may exhibit properties such as increased solubility in polar solvents and potential reactivity due to the ring's electron-rich nature. The benzoyl and benzonitrile groups contribute to its aromatic character, which can influence its stability and reactivity, particularly in electrophilic substitution reactions. This compound may also exhibit interesting photophysical properties, making it a candidate for applications in materials science or organic electronics. Additionally, the presence of multiple functional groups suggests potential for diverse chemical reactivity, including nucleophilic attacks and polymerization. Overall, 4-[4-(1,3-dioxolan-2-yl)benzoyl]benzonitrile is a versatile compound with potential applications in various fields, including pharmaceuticals and organic synthesis.

Formula: C₁₇H₁₃NO₃

InChI: InChI=1/C17H13NO3/c18-11-12-1-3-13(4-2-12)16(19)14-5-7-15(8-6-14)17-20-9-10-21-17/h1-8,17H,9-10H2

SMILES: c1cc(ccc1C#N)C(=O)c1ccc(cc1)C1OCCO1

4-cyano-4'-(1,3-dioxolan-2-yl)benzophenone

CAS: 898759-96-1

Purity: 97.0%

Molecular weight: 279.2950134277344

Ref: 10-F206853