CAS 898759-97-2

Ethyl 2-[4-(1,3-dioxolan-2-yl)benzoyl]benzoate

Description:

Ethyl 2-[4-(1,3-dioxolan-2-yl)benzoyl]benzoate, identified by its CAS number 898759-97-2, is an organic compound characterized by its ester functional group and the presence of a dioxolane ring. This compound features a benzoate moiety, which contributes to its aromatic properties, and a dioxolane ring that enhances its chemical stability and solubility in organic solvents. Typically, such compounds exhibit moderate to high lipophilicity, making them suitable for various applications in organic synthesis and potentially in pharmaceuticals. The presence of the dioxolane ring may also impart unique reactivity, allowing for further functionalization. Ethyl 2-[4-(1,3-dioxolan-2-yl)benzoyl]benzoate may be utilized in the development of advanced materials or as an intermediate in the synthesis of more complex organic molecules. Its specific physical properties, such as boiling point, melting point, and solubility, would depend on the molecular structure and the conditions under which it is studied. Safety data and handling precautions should be consulted due to the potential hazards associated with organic compounds.

Formula: C₁₉H₁₈O₅

InChI: InChI=1S/C19H18O5/c1-2-22-18(21)16-6-4-3-5-15(16)17(20)13-7-9-14(10-8-13)19-23-11-12-24-19/h3-10,19H,2,11-12H2,1H3

InChI key: InChIKey=IGXNOZQDBODOHR-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(C(OCC)=O)C=CC=C1)C2=CC=C(C=C2)C3OCCO3

Synonyms:

• Ethyl 2-[4-(1,3-dioxolan-2-yl)benzoyl]benzoate
• Benzoic acid, 2-[4-(1,3-dioxolan-2-yl)benzoyl]-, ethyl ester