CymitQuimica logo

CAS 898759-98-3

:

ethyl 3-[4-(1,3-dioxolan-2-yl)benzoyl]benzoate

Description:
Ethyl 3-[4-(1,3-dioxolan-2-yl)benzoyl]benzoate is an organic compound characterized by its ester functional group, which is derived from benzoic acid and ethanol. The presence of a dioxolane ring indicates that this compound has a cyclic ether structure, contributing to its unique chemical properties. The compound features a benzoyl group, which enhances its potential for various applications, including in pharmaceuticals and organic synthesis. Its molecular structure suggests that it may exhibit interesting reactivity due to the electron-withdrawing nature of the carbonyl group and the potential for intramolecular interactions. Ethyl 3-[4-(1,3-dioxolan-2-yl)benzoyl]benzoate may also possess specific solubility characteristics, likely being soluble in organic solvents while having limited solubility in water. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as temperature and pH. Overall, this compound's unique structure and functional groups make it a subject of interest in various chemical research and applications.
Formula:C19H18O5
InChI:InChI=1/C19H18O5/c1-2-22-18(21)16-5-3-4-15(12-16)17(20)13-6-8-14(9-7-13)19-23-10-11-24-19/h3-9,12,19H,2,10-11H2,1H3
SMILES:CCOC(=O)c1cccc(c1)C(=O)c1ccc(cc1)C1OCCO1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.