CAS 898760-03-7

[4-(1,1-Dimethylethyl)phenyl]-2-oxazolylmethanone

Description:

[4-(1,1-Dimethylethyl)phenyl]-2-oxazolylmethanone, identified by its CAS number 898760-03-7, is a chemical compound characterized by its unique structural features. It contains an oxazole ring, which is a five-membered heterocyclic compound featuring both nitrogen and oxygen atoms, contributing to its potential reactivity and biological activity. The presence of a bulky tert-butyl group (1,1-dimethylethyl) on the phenyl ring enhances its steric properties, potentially influencing its interactions in various chemical environments. This compound may exhibit properties such as fluorescence or photostability, making it of interest in fields like materials science or organic synthesis. Additionally, the oxazolylmethanone moiety suggests potential applications in medicinal chemistry, possibly as a precursor for biologically active molecules. Its solubility, stability, and reactivity would depend on the specific conditions, including solvent and temperature. Overall, this compound represents a versatile structure with potential applications in various chemical and pharmaceutical domains.

Formula: C₁₄H₁₅NO₂

InChI: InChI=1S/C14H15NO2/c1-14(2,3)11-6-4-10(5-7-11)12(16)13-15-8-9-17-13/h4-9H,1-3H3

InChI key: InChIKey=RYDNYBLBWYGSSI-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC=C(C(C)(C)C)C=C1)C2=NC=CO2

Synonyms:

• Methanone, [4-(1,1-dimethylethyl)phenyl]-2-oxazolyl-
• [4-(1,1-Dimethylethyl)phenyl]-2-oxazolylmethanone

2-(4-t-Butylbenzoyl)oxazole

CAS: 898760-03-7

Formula: C₁₄H₁₅NO₂

Purity: 97.0%

Molecular weight: 229.279

Ref: 10-F202650