CAS 898760-07-1
:oxazol-2-yl-(4-propylphenyl)methanone
Description:
Oxazol-2-yl-(4-propylphenyl)methanone, identified by its CAS number 898760-07-1, is an organic compound characterized by the presence of an oxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen atoms. This compound features a propyl group attached to a phenyl ring, contributing to its hydrophobic characteristics and potentially influencing its solubility and reactivity. The methanone functional group indicates the presence of a carbonyl group (C=O) adjacent to the oxazole, which can participate in various chemical reactions, including nucleophilic attacks and condensation reactions. The overall structure suggests potential applications in pharmaceuticals or materials science, particularly due to the unique properties imparted by the oxazole moiety and the aromatic system. Additionally, the presence of substituents like the propyl group can affect the compound's biological activity and interaction with other molecules. As with many organic compounds, its physical properties, such as melting point, boiling point, and solubility, would need to be determined experimentally for specific applications.
Formula:C13H13NO2
InChI:InChI=1/C13H13NO2/c1-2-3-10-4-6-11(7-5-10)12(15)13-14-8-9-16-13/h4-9H,2-3H2,1H3
InChI key:InChIKey=ABLNLEMDZDCPIR-UHFFFAOYSA-N
SMILES:CCCc1ccc(cc1)C(=O)c1ncco1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.