CAS 898760-08-2

Methanone, (4-bromophenyl)[4-(1,3-dioxolan-2-yl)phenyl]-

Description:

Methanone, (4-bromophenyl)[4-(1,3-dioxolan-2-yl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and two phenyl rings, one of which is substituted with a bromine atom. The presence of a 1,3-dioxolane ring adds to its molecular complexity, contributing to its potential reactivity and interactions. This compound is likely to exhibit properties typical of aromatic ketones, such as stability under standard conditions and potential for electrophilic substitution reactions. The bromine substituent may enhance its reactivity due to the electron-withdrawing nature of the halogen, while the dioxolane moiety could influence solubility and polarity. Methanone derivatives often find applications in pharmaceuticals and materials science due to their ability to participate in various chemical reactions, including cross-coupling and condensation reactions. However, specific applications and reactivity would depend on the overall molecular context and the presence of other functional groups. Safety and handling considerations should be observed, as with all chemical substances, particularly those with halogen substituents.

Formula: C₁₆H₁₃BrO₃

InChI: InChI=1S/C16H13BrO3/c17-14-7-5-12(6-8-14)15(18)11-1-3-13(4-2-11)16-19-9-10-20-16/h1-8,16H,9-10H2

InChI key: InChIKey=HJOBTKFIYJCVEA-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC=C(C=C1)C2OCCO2)C3=CC=C(Br)C=C3

Synonyms:

• Methanone, (4-bromophenyl)[4-(1,3-dioxolan-2-yl)phenyl]-
• (4-Bromophenyl)[4-(1,3-dioxolan-2-yl)phenyl]methanone
• 4-Bromo-4′-(1,3-dioxolan-2-yl)benzophenone

4-bromo-4'-(1,3-dioxolan-2-yl)benzophenone

CAS: 898760-08-2

Purity: 97.0%

Molecular weight: 333.1809997558594

Ref: 10-F206860