CymitQuimica logo

CAS 898760-11-7

:

2-Oxazolyl(4-pentylphenyl)methanone

Description:
2-Oxazolyl(4-pentylphenyl)methanone, identified by its CAS number 898760-11-7, is an organic compound characterized by the presence of an oxazole ring and a ketone functional group. The oxazole moiety contributes to its heterocyclic nature, while the pentylphenyl group enhances its hydrophobic characteristics, potentially influencing its solubility and interaction with biological systems. This compound may exhibit interesting photophysical properties, making it a candidate for applications in organic electronics or as a fluorescent probe. Its structure suggests potential reactivity due to the presence of the carbonyl group, which can participate in various chemical reactions, including nucleophilic additions. Additionally, the presence of the oxazole ring may impart specific biological activities, as many oxazole derivatives are known for their pharmacological properties. Overall, the unique combination of functional groups in 2-Oxazolyl(4-pentylphenyl)methanone suggests a versatile compound with potential applications in materials science and medicinal chemistry.
Formula:C15H17NO2
InChI:InChI=1/C15H17NO2/c1-2-3-4-5-12-6-8-13(9-7-12)14(17)15-16-10-11-18-15/h6-11H,2-5H2,1H3
InChI key:InChIKey=GXJUUBJDTMZAPI-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC=C(CCCCC)C=C1)C2=NC=CO2
Synonyms:
  • 2-Oxazolyl(4-pentylphenyl)methanone
  • Methanone, 2-oxazolyl(4-pentylphenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.