CAS 898760-12-8

Methanone, [4-(1,3-dioxolan-2-yl)phenyl](3-fluorophenyl)-

Description:

Methanone, [4-(1,3-dioxolan-2-yl)phenyl](3-fluorophenyl)-, also known by its CAS number 898760-12-8, is an organic compound characterized by its unique structure that includes a methanone functional group and a phenyl ring substituted with a 1,3-dioxolane moiety. This compound features a fluorine atom on one of the phenyl rings, which can influence its chemical reactivity and physical properties. The presence of the dioxolane ring suggests potential for interesting interactions due to its ether-like characteristics, which may affect solubility and stability. Methanones are generally known for their applications in pharmaceuticals and agrochemicals, often serving as intermediates in the synthesis of more complex molecules. The specific arrangement of functional groups in this compound may also impart unique biological activities, making it a candidate for further research in medicinal chemistry. Overall, the compound's properties, including its reactivity, solubility, and potential applications, would be influenced by the interplay of its functional groups and molecular structure.

Formula: C₁₆H₁₃FO₃

InChI: InChI=1S/C16H13FO3/c17-14-3-1-2-13(10-14)15(18)11-4-6-12(7-5-11)16-19-8-9-20-16/h1-7,10,16H,8-9H2

InChI key: InChIKey=AMQGRWVDMUZSEL-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC=C(C=C1)C2OCCO2)C3=CC(F)=CC=C3

Synonyms:

• Methanone, [4-(1,3-dioxolan-2-yl)phenyl](3-fluorophenyl)-
• 4′-(1,3-Dioxolan-2-yl)-3-fluorobenzophenone
• [4-(1,3-Dioxolan-2-yl)phenyl](3-fluorophenyl)methanone

4'-(1,3-dioxolan-2-yl)-3-fluorobenzophenone

CAS: 898760-12-8

Purity: 97.0%

Molecular weight: 272.2749938964844

Ref: 10-F206863