CAS 898760-13-9

(4-Hexylphenyl)-2-oxazolylmethanone

Description:

(4-Hexylphenyl)-2-oxazolylmethanone, identified by its CAS number 898760-13-9, is an organic compound characterized by its unique structure that includes a hexyl-substituted phenyl group and an oxazole ring. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, which may include moderate to high stability under standard conditions. The presence of the oxazole moiety suggests potential applications in fields such as pharmaceuticals or materials science, where heterocycles are often valued for their biological activity and functional properties. Additionally, the hexyl group contributes to the compound's hydrophobic characteristics, potentially influencing its solubility and interaction with biological membranes. The compound may also exhibit fluorescence or other optical properties, making it of interest in photonic applications. As with many organic compounds, its reactivity can be influenced by the functional groups present, and it may participate in various chemical reactions, including substitution and addition reactions, depending on the conditions. Safety and handling precautions should be observed, as with all chemical substances.

Formula: C₁₆H₁₉NO₂

InChI: InChI=1S/C16H19NO2/c1-2-3-4-5-6-13-7-9-14(10-8-13)15(18)16-17-11-12-19-16/h7-12H,2-6H2,1H3

InChI key: InChIKey=VEGGMCLDNBNKTL-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC=C(CCCCCC)C=C1)C2=NC=CO2

Synonyms:

• Methanone, (4-hexylphenyl)-2-oxazolyl-
• (4-Hexylphenyl)-2-oxazolylmethanone