CymitQuimica logo

CAS 898760-16-2

:

Methanone, (2,3-dimethylphenyl)[4-(1,3-dioxolan-2-yl)phenyl]-

Description:
Methanone, (2,3-dimethylphenyl)[4-(1,3-dioxolan-2-yl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of the 2,3-dimethylphenyl group indicates that it has two methyl substituents on a phenyl ring, contributing to its hydrophobic characteristics and potential for steric hindrance. The 4-(1,3-dioxolan-2-yl)phenyl moiety introduces a dioxolane ring, which is a five-membered cyclic ether, adding to the compound's polarity and potential for hydrogen bonding. This compound may exhibit interesting chemical reactivity due to the presence of both electron-donating and electron-withdrawing groups, influencing its behavior in various chemical reactions. Additionally, its structural complexity suggests potential applications in pharmaceuticals or materials science, where such compounds can serve as intermediates or functional materials. Overall, the unique combination of functional groups and structural features makes this compound a subject of interest in organic chemistry.
Formula:C18H18O3
InChI:InChI=1S/C18H18O3/c1-12-4-3-5-16(13(12)2)17(19)14-6-8-15(9-7-14)18-20-10-11-21-18/h3-9,18H,10-11H2,1-2H3
InChI key:InChIKey=UVZDYYYYEIDHTK-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC=C(C=C1)C2OCCO2)C3=C(C)C(C)=CC=C3
Synonyms:
  • (2,3-Dimethylphenyl)[4-(1,3-dioxolan-2-yl)phenyl]methanone
  • Methanone, (2,3-dimethylphenyl)[4-(1,3-dioxolan-2-yl)phenyl]-
  • 2,3-Dimethyl-4′-(1,3-dioxolan-2-yl)benzophenone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.