CAS 898760-17-3

(4-Ethoxyphenyl)-2-oxazolylmethanone

Description:

(4-Ethoxyphenyl)-2-oxazolylmethanone, identified by its CAS number 898760-17-3, is a chemical compound characterized by its unique structural features. It contains an oxazole ring, which is a five-membered heterocyclic compound containing both nitrogen and oxygen atoms, contributing to its potential biological activity. The presence of the ethoxy group attached to the phenyl ring enhances its solubility and may influence its reactivity and interaction with biological targets. This compound is typically synthesized through organic reactions involving appropriate precursors, and its properties may include moderate to high stability under standard conditions. It may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. The compound's molecular interactions, such as hydrogen bonding and π-π stacking, can play a significant role in its biological efficacy. As with many organic compounds, its behavior in various solvents and under different conditions can vary, impacting its applications in research and industry. Further studies are often required to fully elucidate its potential uses and mechanisms of action.

Formula: C₁₂H₁₁NO₃

InChI: InChI=1/C12H11NO3/c1-2-15-10-5-3-9(4-6-10)11(14)12-13-7-8-16-12/h3-8H,2H2,1H3

InChI key: InChIKey=ITTBPAVMPMOSSO-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC=C(OCC)C=C1)C2=NC=CO2

Synonyms:

• Methanone, (4-ethoxyphenyl)-2-oxazolyl-
• (4-Ethoxyphenyl)-2-oxazolylmethanone