CAS 898760-25-3
:(2,6-dimethylphenyl)-[4-(1,3-dioxolan-2-yl)phenyl]methanone
Description:
The chemical substance known as (2,6-dimethylphenyl)-[4-(1,3-dioxolan-2-yl)phenyl]methanone, with the CAS number 898760-25-3, is an organic compound characterized by its complex structure, which includes a ketone functional group and a dioxolane ring. This compound features a phenyl group substituted with two methyl groups at the 2 and 6 positions, contributing to its hydrophobic characteristics and potential for various interactions. The presence of the dioxolane moiety suggests that it may exhibit unique reactivity and solubility properties, particularly in polar solvents. The compound's molecular structure indicates potential applications in organic synthesis, pharmaceuticals, or as a precursor in material science. Its stability, reactivity, and specific interactions with biological systems would depend on the overall electronic distribution and steric effects imparted by the substituents. As with many organic compounds, safety data and handling precautions should be considered, particularly regarding its potential toxicity and environmental impact.
Formula:C18H18O3
InChI:InChI=1S/C18H18O3/c1-12-4-3-5-13(2)16(12)17(19)14-6-8-15(9-7-14)18-20-10-11-21-18/h3-9,18H,10-11H2,1-2H3
InChI key:InChIKey=BIXMGGXAHGPDJA-UHFFFAOYSA-N
SMILES:Cc1cccc(C)c1C(=O)c1ccc(cc1)C1OCCO1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.