CAS 898760-30-0
:1-Propanone, 3-(3-bromophenyl)-1-(3,4-dimethylphenyl)-
Description:
1-Propanone, 3-(3-bromophenyl)-1-(3,4-dimethylphenyl)-, also known by its CAS number 898760-30-0, is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with two distinct aromatic substituents: a bromophenyl group and a dimethylphenyl group. The presence of the bromine atom introduces notable reactivity and influences the compound's physical properties, such as its boiling point and solubility. The dimethyl groups on the phenyl ring can affect steric hindrance and electronic properties, potentially impacting its reactivity in chemical reactions. Typically, compounds of this nature may exhibit moderate to high lipophilicity due to the aromatic rings, which can influence their behavior in biological systems and their applications in organic synthesis. Additionally, the compound may be of interest in medicinal chemistry or materials science, depending on its specific properties and reactivity patterns. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or environmental impact.
Formula:C17H17BrO
InChI:InChI=1S/C17H17BrO/c1-12-6-8-15(10-13(12)2)17(19)9-7-14-4-3-5-16(18)11-14/h3-6,8,10-11H,7,9H2,1-2H3
InChI key:InChIKey=SZYYQGYBOJCZOC-UHFFFAOYSA-N
SMILES:C(CCC1=CC(Br)=CC=C1)(=O)C2=CC(C)=C(C)C=C2
Synonyms:- 1-Propanone, 3-(3-bromophenyl)-1-(3,4-dimethylphenyl)-
- 3-(3-Bromophenyl)-1-(3,4-dimethylphenyl)propan-1-one
- 3-(3-Bromophenyl)-3′,4′-dimethylpropiophenone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.