CAS 898760-34-4

Methanone, (4-bromo-3-fluorophenyl)[4-(1,3-dioxolan-2-yl)phenyl]-

Description:

Methanone, (4-bromo-3-fluorophenyl)[4-(1,3-dioxolan-2-yl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of bromine and fluorine substituents on the phenyl rings contributes to its unique chemical properties, potentially influencing its reactivity and interaction with other molecules. The 1,3-dioxolane moiety introduces a cyclic ether component, which can enhance solubility and stability in various solvents. This compound may exhibit interesting biological activities due to its structural features, making it a candidate for research in medicinal chemistry. Its molecular structure suggests potential applications in pharmaceuticals or agrochemicals, although specific biological or chemical properties would require empirical investigation. As with many halogenated compounds, considerations regarding environmental impact and safety are essential during handling and application. Overall, the compound's characteristics are defined by its functional groups, molecular geometry, and substituent effects, which collectively influence its chemical behavior and potential applications.

Formula: C₁₆H₁₂BrFO₃

InChI: InChI=1S/C16H12BrFO3/c17-13-6-5-12(9-14(13)18)15(19)10-1-3-11(4-2-10)16-20-7-8-21-16/h1-6,9,16H,7-8H2

InChI key: InChIKey=IVZFMAMVXZEGAQ-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC=C(C=C1)C2OCCO2)C3=CC(F)=C(Br)C=C3

Synonyms:

• (4-Bromo-3-fluorophenyl)[4-(1,3-dioxolan-2-yl)phenyl]methanone
• Methanone, (4-bromo-3-fluorophenyl)[4-(1,3-dioxolan-2-yl)phenyl]-
• 4-Bromo-4′-(1,3-dioxolan-2-yl)-3-fluorobenzophenone