CAS 898760-37-7
:(4-chloro-3-fluoro-phenyl)-[4-(1,3-dioxolan-2-yl)phenyl]methanone
Description:
The chemical substance known as (4-chloro-3-fluoro-phenyl)-[4-(1,3-dioxolan-2-yl)phenyl]methanone, with the CAS number 898760-37-7, is a synthetic organic compound characterized by its complex structure, which includes a phenyl ring substituted with both chlorine and fluorine atoms, as well as a methanone functional group. The presence of the 1,3-dioxolane moiety indicates that it contains a five-membered cyclic ether, contributing to its potential reactivity and solubility properties. This compound may exhibit interesting biological activities due to its unique functional groups, making it a candidate for pharmaceutical research. Its molecular structure suggests that it could participate in various chemical reactions, including electrophilic aromatic substitution and nucleophilic attacks, depending on the conditions. Additionally, the presence of halogen substituents often influences the compound's electronic properties, potentially enhancing its reactivity or altering its interaction with biological targets. Overall, this compound's characteristics make it a subject of interest in both synthetic chemistry and medicinal chemistry.
Formula:C16H12ClFO3
InChI:InChI=1/C16H12ClFO3/c17-13-6-5-12(9-14(13)18)15(19)10-1-3-11(4-2-10)16-20-7-8-21-16/h1-6,9,16H,7-8H2
SMILES:c1cc(ccc1C(=O)c1ccc(c(c1)F)Cl)C1OCCO1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.